About (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine
(6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine (PubChem CID 145459440) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine |
| PubChem CID | 145459440 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine |
| SMILES | C=CC[C@@](C)(CC)C1=CC(=N\C)/C(=C\C)C=C1 |
| InChI | InChI=1S/C16H23N/c1-6-11-16(4,8-3)14-10-9-13(7-2)15(12-14)17-5/h6-7,9-10,12H,1,8,11H2,2-5H3/b13-7-,17-15+/t16-/m1/s1 |
| InChIKey | HIMIURJNLHGPAA-NZJYTSTLSA-N |
| XLogP | 4.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine?
The IUPAC name of (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine (CID 145459440) is (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine.
What is the SMILES notation for (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine?
The canonical SMILES for (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine is C=CC[C@@](C)(CC)C1=CC(=N\C)/C(=C\C)C=C1.
What is the InChIKey of (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine?
The InChIKey is HIMIURJNLHGPAA-NZJYTSTLSA-N. The full InChI is InChI=1S/C16H23N/c1-6-11-16(4,8-3)14-10-9-13(7-2)15(12-14)17-5/h6-7,9-10,12H,1,8,11H2,2-5H3/b13-7-,17-15+/t16-/m1/s1.
What are the key properties of (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine?
(6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine has a molecular weight of 229.37 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-ethylidene-N-methyl-3-[(3R)-3-methylhex-5-en-3-yl]cyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 145459440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).