C24H25FN4O — CID 145460262
2-amino-6-[(3E,5Z)-2-(2-fluoro-3-pyridinyl)hepta-1,3,5-trien-4-yl]-3,6-dimethyl-5-phenyl-5H-pyrimidin-4-one (PubChem CID 145460262) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-amino-6-[(3E,5Z)-2-(2-fluoro-3-pyridinyl)hepta-1,3,5-trien-4-yl]-3,6-dimethyl-5-phenyl-5H-pyrimidin-4-one.
| Compound Name | 2-amino-6-[(3E,5Z)-2-(2-fluoro-3-pyridinyl)hepta-1,3,5-trien-4-yl]-3,6-dimethyl-5-phenyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 145460262 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-amino-6-[(3E,5Z)-2-(2-fluoro-3-pyridinyl)hepta-1,3,5-trien-4-yl]-3,6-dimethyl-5-phenyl-5H-pyrimidin-4-one |
| SMILES | C=C(/C=C(\C=C/C)C1(C)N=C(N)N(C)C(=O)C1c1ccccc1)c1cccnc1F |
| InChI | InChI=1S/C24H25FN4O/c1-5-10-18(15-16(2)19-13-9-14-27-21(19)25)24(3)20(17-11-7-6-8-12-17)22(30)29(4)23(26)28-24/h5-15,20H,2H2,1,3-4H3,(H2,26,28)/b10-5-,18-15+ |
| InChIKey | DAYPPUNEYYJBDD-JJDRHRIQSA-N |
| XLogP | 4.07 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|