C24H26F2N4O2S — CID 145460455
2-[3-[4-(1,1-difluoroethyl)phenyl]-2-[4-(5-hydroxy-3-pyridinyl)thiophen-2-yl]-4-oxobutan-2-yl]-1,1-dimethylguanidine (PubChem CID 145460455) has the molecular formula C24H26F2N4O2S and a molecular weight of 472.56 g/mol. Its IUPAC name is 2-[3-[4-(1,1-difluoroethyl)phenyl]-2-[4-(5-hydroxy-3-pyridinyl)thiophen-2-yl]-4-oxobutan-2-yl]-1,1-dimethylguanidine.
| Compound Name | 2-[3-[4-(1,1-difluoroethyl)phenyl]-2-[4-(5-hydroxy-3-pyridinyl)thiophen-2-yl]-4-oxobutan-2-yl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 145460455 |
| Molecular Formula | C24H26F2N4O2S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-[3-[4-(1,1-difluoroethyl)phenyl]-2-[4-(5-hydroxy-3-pyridinyl)thiophen-2-yl]-4-oxobutan-2-yl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N\C(C)(c1cc(-c2cncc(O)c2)cs1)C(C=O)c1ccc(C(C)(F)F)cc1 |
| InChI | InChI=1S/C24H26F2N4O2S/c1-23(29-22(27)30(3)4,20(13-31)15-5-7-18(8-6-15)24(2,25)26)21-10-17(14-33-21)16-9-19(32)12-28-11-16/h5-14,20,32H,1-4H3,(H2,27,29) |
| InChIKey | WOLWGEKORFGSDC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|