C29H30I2N5O3S- — CID 145460584
benzyl 4-[(4S,5S)-2-amino-4-[4-(5-cyano-3-pyridinyl)thiophen-2-yl]-4-methyl-1-methyliodanuidyl-6-oxo-5H-1λ3,3-iodazin-5-yl]piperidine-1-carboxylate (PubChem CID 145460584) has the molecular formula C29H30I2N5O3S- and a molecular weight of 782.47 g/mol. Its IUPAC name is benzyl 4-[(4S,5S)-2-amino-4-[4-(5-cyano-3-pyridinyl)thiophen-2-yl]-4-methyl-1-methyliodanuidyl-6-oxo-5H-1λ3,3-iodazin-5-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(4S,5S)-2-amino-4-[4-(5-cyano-3-pyridinyl)thiophen-2-yl]-4-methyl-1-methyliodanuidyl-6-oxo-5H-1λ3,3-iodazin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145460584 |
| Molecular Formula | C29H30I2N5O3S- |
| Molecular Weight | 782.47 g/mol |
| Exact Mass | 782.02 |
| IUPAC Name | benzyl 4-[(4S,5S)-2-amino-4-[4-(5-cyano-3-pyridinyl)thiophen-2-yl]-4-methyl-1-methyliodanuidyl-6-oxo-5H-1λ3,3-iodazin-5-yl]piperidine-1-carboxylate |
| SMILES | C[I-]I1C(=O)[C@@H](C2CCN(C(=O)OCc3ccccc3)CC2)[C@@](C)(c2cc(-c3cncc(C#N)c3)cs2)N=C1N |
| InChI | InChI=1S/C29H30I2N5O3S/c1-29(24-13-23(18-40-24)22-12-20(14-32)15-34-16-22)25(26(37)31(30-2)27(33)35-29)21-8-10-36(11-9-21)28(38)39-17-19-6-4-3-5-7-19/h3-7,12-13,15-16,18,21,25H,8-11,17H2,1-2H3,(H2,33,35)/q-1/t25-,29-/m1/s1 |
| InChIKey | NUYDXORLZYODRG-VAVYLYDRSA-N |
| XLogP | 2.56 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|