About 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene
3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene (PubChem CID 145460743) has the molecular formula C11H12S
and a molecular weight of 176.28 g/mol. Its IUPAC name is 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene.
Molecular Properties
| Compound Name | 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene |
| PubChem CID | 145460743 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene |
| SMILES | CC1=CCCC(c2ccsc2)=C1 |
| InChI | InChI=1S/C11H12S/c1-9-3-2-4-10(7-9)11-5-6-12-8-11/h3,5-8H,2,4H2,1H3 |
| InChIKey | HPWNJJBIVRFMEC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene?
The IUPAC name of 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene (CID 145460743) is 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene.
What is the SMILES notation for 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene?
The canonical SMILES for 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene is CC1=CCCC(c2ccsc2)=C1.
What is the InChIKey of 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene?
The InChIKey is HPWNJJBIVRFMEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12S/c1-9-3-2-4-10(7-9)11-5-6-12-8-11/h3,5-8H,2,4H2,1H3.
What are the key properties of 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene?
3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene has a molecular weight of 176.28 g/mol, XLogP of 3.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylcyclohexa-1,3-dien-1-yl)thiophene is sourced from PubChem (CID 145460743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).