About 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one
2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one (PubChem CID 145461171) has the molecular formula C26H33N3O
and a molecular weight of 403.57 g/mol. Its IUPAC name is 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one.
Molecular Properties
| Compound Name | 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one |
| PubChem CID | 145461171 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one |
| SMILES | C=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1CCCCCN1CCCCC1 |
| InChI | InChI=1S/C26H33N3O/c1-22-27-26(23-14-6-2-7-15-23,24-16-8-3-9-17-24)25(30)29(22)21-13-5-12-20-28-18-10-4-11-19-28/h2-3,6-9,14-17,27H,1,4-5,10-13,18-21H2 |
| InChIKey | ZQSDRSCUZVONHO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one?
The IUPAC name of 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one (CID 145461171) is 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one.
What is the SMILES notation for 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one?
The canonical SMILES for 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one is C=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1CCCCCN1CCCCC1.
What is the InChIKey of 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one?
The InChIKey is ZQSDRSCUZVONHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H33N3O/c1-22-27-26(23-14-6-2-7-15-23,24-16-8-3-9-17-24)25(30)29(22)21-13-5-12-20-28-18-10-4-11-19-28/h2-3,6-9,14-17,27H,1,4-5,10-13,18-21H2.
What are the key properties of 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one?
2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one has a molecular weight of 403.57 g/mol, XLogP of 4.49, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-5,5-diphenyl-3-(5-piperidin-1-ylpentyl)imidazolidin-4-one is sourced from PubChem (CID 145461171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).