About 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one
2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one (PubChem CID 145461543) has the molecular formula C29H31N3O2
and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one.
Molecular Properties
| Compound Name | 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one |
| PubChem CID | 145461543 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1ccc(C2CCCCOCC2)cc1 |
| InChI | InChI=1S/C29H31N3O2/c30-28-31-29(25-10-3-1-4-11-25,26-12-5-2-6-13-26)27(33)32(28)21-22-14-16-24(17-15-22)23-9-7-8-19-34-20-18-23/h1-6,10-17,23H,7-9,18-21H2,(H2,30,31) |
| InChIKey | DZLUYRRXEXCCFW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
The IUPAC name of 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one (CID 145461543) is 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one.
What is the SMILES notation for 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
The canonical SMILES for 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one is NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1ccc(C2CCCCOCC2)cc1.
What is the InChIKey of 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
The InChIKey is DZLUYRRXEXCCFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H31N3O2/c30-28-31-29(25-10-3-1-4-11-25,26-12-5-2-6-13-26)27(33)32(28)21-22-14-16-24(17-15-22)23-9-7-8-19-34-20-18-23/h1-6,10-17,23H,7-9,18-21H2,(H2,30,31).
What are the key properties of 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one has a molecular weight of 453.59 g/mol, XLogP of 4.96, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[[4-(oxocan-4-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one is sourced from PubChem (CID 145461543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).