About 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol
2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol (PubChem CID 145461874) has the molecular formula C17H20N4O2
and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol.
Molecular Properties
| Compound Name | 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol |
| PubChem CID | 145461874 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol |
| SMILES | CC1CC(=O)N(C)C(N)=N1.Oc1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C11H9NO.C6H11N3O/c13-10-5-3-4-9(8-10)11-6-1-2-7-12-11;1-4-3-5(10)9(2)6(7)8-4/h1-8,13H;4H,3H2,1-2H3,(H2,7,8) |
| InChIKey | UEEBFVAKXURHTQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol?
The IUPAC name of 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol (CID 145461874) is 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol.
What is the SMILES notation for 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol?
The canonical SMILES for 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol is CC1CC(=O)N(C)C(N)=N1.Oc1cccc(-c2ccccn2)c1.
What is the InChIKey of 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol?
The InChIKey is UEEBFVAKXURHTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO.C6H11N3O/c13-10-5-3-4-9(8-10)11-6-1-2-7-12-11;1-4-3-5(10)9(2)6(7)8-4/h1-8,13H;4H,3H2,1-2H3,(H2,7,8).
What are the key properties of 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol?
2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol has a molecular weight of 312.37 g/mol, XLogP of 2.01, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one;3-pyridin-2-ylphenol is sourced from PubChem (CID 145461874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).