C12H16N3Rf- — CID 145462184
(4S)-4-cyclopenta-1,3-dien-1-yl-1,4-dimethyl-6-methylidene-5H-pyrimidin-2-amine;rutherfordium (PubChem CID 145462184) has the molecular formula C12H16N3Rf- and a molecular weight of 469.28 g/mol. Its IUPAC name is (4S)-4-cyclopenta-1,3-dien-1-yl-1,4-dimethyl-6-methylidene-5H-pyrimidin-2-amine;rutherfordium.
| Compound Name | (4S)-4-cyclopenta-1,3-dien-1-yl-1,4-dimethyl-6-methylidene-5H-pyrimidin-2-amine;rutherfordium |
|---|---|
| PubChem CID | 145462184 |
| Molecular Formula | C12H16N3Rf- |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | (4S)-4-cyclopenta-1,3-dien-1-yl-1,4-dimethyl-6-methylidene-5H-pyrimidin-2-amine;rutherfordium |
| SMILES | C=C1C[C@@](C)(C2=C[C-]=CC2)N=C(N)N1C.[Rf] |
| InChI | InChI=1S/C12H16N3.Rf/c1-9-8-12(2,10-6-4-5-7-10)14-11(13)15(9)3;/h4,7H,1,6,8H2,2-3H3,(H2,13,14);/q-1;/t12-;/m0./s1 |
| InChIKey | GMSXPJCTFSQUAQ-YDALLXLXSA-N |
| XLogP | 1.60 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|