C25H32F3N5O2 — CID 145463393
1-[3-[[2-(ethylamino)ethylamino]methyl]phenyl]-N-[(2Z,4Z)-3-methoxy-2-methylhepta-2,4,6-trienyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 145463393) has the molecular formula C25H32F3N5O2 and a molecular weight of 491.56 g/mol. Its IUPAC name is 1-[3-[[2-(ethylamino)ethylamino]methyl]phenyl]-N-[(2Z,4Z)-3-methoxy-2-methylhepta-2,4,6-trienyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-[3-[[2-(ethylamino)ethylamino]methyl]phenyl]-N-[(2Z,4Z)-3-methoxy-2-methylhepta-2,4,6-trienyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 145463393 |
| Molecular Formula | C25H32F3N5O2 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 1-[3-[[2-(ethylamino)ethylamino]methyl]phenyl]-N-[(2Z,4Z)-3-methoxy-2-methylhepta-2,4,6-trienyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | C=C/C=C\C(OC)=C(/C)CNC(=O)c1cc(C(F)(F)F)nn1-c1cccc(CNCCNCC)c1 |
| InChI | InChI=1S/C25H32F3N5O2/c1-5-7-11-22(35-4)18(3)16-31-24(34)21-15-23(25(26,27)28)32-33(21)20-10-8-9-19(14-20)17-30-13-12-29-6-2/h5,7-11,14-15,29-30H,1,6,12-13,16-17H2,2-4H3,(H,31,34)/b11-7-,22-18- |
| InChIKey | QDBWSPKXBHWFHU-WMAUFAJMSA-N |
| XLogP | 3.98 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|