About S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine
S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine (PubChem CID 145463619) has the molecular formula C14H12FNOS
and a molecular weight of 261.32 g/mol. Its IUPAC name is S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine.
Molecular Properties
| Compound Name | S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine |
| PubChem CID | 145463619 |
| Molecular Formula | C14H12FNOS |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine |
| SMILES | NSc1cc(-c2cccc(F)c2)cc2c1OCC2 |
| InChI | InChI=1S/C14H12FNOS/c15-12-3-1-2-9(7-12)11-6-10-4-5-17-14(10)13(8-11)18-16/h1-3,6-8H,4-5,16H2 |
| InChIKey | OICLWLLOYJLVLC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine?
The IUPAC name of S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine (CID 145463619) is S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine.
What is the SMILES notation for S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine?
The canonical SMILES for S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine is NSc1cc(-c2cccc(F)c2)cc2c1OCC2.
What is the InChIKey of S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine?
The InChIKey is OICLWLLOYJLVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FNOS/c15-12-3-1-2-9(7-12)11-6-10-4-5-17-14(10)13(8-11)18-16/h1-3,6-8H,4-5,16H2.
What are the key properties of S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine?
S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine has a molecular weight of 261.32 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[5-(3-fluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine is sourced from PubChem (CID 145463619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).