C32H31F5O — CID 145464255
(3E,7Z,11E,15Z)-17-[difluoro-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]oxymethyl]-4,12-difluoro-2-methyl-5,6,9,10,13,14-hexamethylideneoctadeca-1,3,7,11,15,17-hexaene (PubChem CID 145464255) has the molecular formula C32H31F5O and a molecular weight of 526.59 g/mol. Its IUPAC name is (3E,7Z,11E,15Z)-17-[difluoro-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]oxymethyl]-4,12-difluoro-2-methyl-5,6,9,10,13,14-hexamethylideneoctadeca-1,3,7,11,15,17-hexaene.
| Compound Name | (3E,7Z,11E,15Z)-17-[difluoro-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]oxymethyl]-4,12-difluoro-2-methyl-5,6,9,10,13,14-hexamethylideneoctadeca-1,3,7,11,15,17-hexaene |
|---|---|
| PubChem CID | 145464255 |
| Molecular Formula | C32H31F5O |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (3E,7Z,11E,15Z)-17-[difluoro-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]oxymethyl]-4,12-difluoro-2-methyl-5,6,9,10,13,14-hexamethylideneoctadeca-1,3,7,11,15,17-hexaene |
| SMILES | C=C(F)/C=C\C(=C)OC(F)(F)C(=C)/C=C\C(=C)C(=C)/C(F)=C/C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C\C(=C)C |
| InChI | InChI=1S/C32H31F5O/c1-20(2)18-30(34)28(10)22(4)13-12-21(3)24(6)19-31(35)29(11)23(5)14-15-25(7)32(36,37)38-27(9)17-16-26(8)33/h12-19H,1,3-11H2,2H3/b13-12-,15-14-,17-16-,30-18+,31-19+ |
| InChIKey | DOGFEGZYBKBSEE-POBGTHHMSA-N |
| XLogP | 10.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|