About 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol
4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol (PubChem CID 145464533) has the molecular formula C23H24F3N3O3
and a molecular weight of 447.46 g/mol. Its IUPAC name is 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol.
Molecular Properties
| Compound Name | 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol |
| PubChem CID | 145464533 |
| Molecular Formula | C23H24F3N3O3 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol |
| SMILES | COc1ccc(-c2c(C(F)(F)F)c(C3(O)CCNCC3)nn2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H24F3N3O3/c1-31-17-7-3-15(4-8-17)20-19(23(24,25)26)21(22(30)11-13-27-14-12-22)28-29(20)16-5-9-18(32-2)10-6-16/h3-10,27,30H,11-14H2,1-2H3 |
| InChIKey | WOYVMJQCFWLPKT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol?
The IUPAC name of 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol (CID 145464533) is 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol.
What is the SMILES notation for 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol?
The canonical SMILES for 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol is COc1ccc(-c2c(C(F)(F)F)c(C3(O)CCNCC3)nn2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol?
The InChIKey is WOYVMJQCFWLPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24F3N3O3/c1-31-17-7-3-15(4-8-17)20-19(23(24,25)26)21(22(30)11-13-27-14-12-22)28-29(20)16-5-9-18(32-2)10-6-16/h3-10,27,30H,11-14H2,1-2H3.
What are the key properties of 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol?
4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol has a molecular weight of 447.46 g/mol, XLogP of 4.15, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,5-bis(4-methoxyphenyl)-4-(trifluoromethyl)pyrazol-3-yl]piperidin-4-ol is sourced from PubChem (CID 145464533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).