C24H23N2P — CID 145465184
[4-methyl-2-[4-(4-propylphenyl)phenyl]-1,6-naphthyridin-7-yl]phosphane (PubChem CID 145465184) has the molecular formula C24H23N2P and a molecular weight of 370.44 g/mol. Its IUPAC name is [4-methyl-2-[4-(4-propylphenyl)phenyl]-1,6-naphthyridin-7-yl]phosphane.
| Compound Name | [4-methyl-2-[4-(4-propylphenyl)phenyl]-1,6-naphthyridin-7-yl]phosphane |
|---|---|
| PubChem CID | 145465184 |
| Molecular Formula | C24H23N2P |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [4-methyl-2-[4-(4-propylphenyl)phenyl]-1,6-naphthyridin-7-yl]phosphane |
| SMILES | CCCc1ccc(-c2ccc(-c3cc(C)c4cnc(P)cc4n3)cc2)cc1 |
| InChI | InChI=1S/C24H23N2P/c1-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)22-13-16(2)21-15-25-24(27)14-23(21)26-22/h5-15H,3-4,27H2,1-2H3 |
| InChIKey | AXQRKAAEBIPKNN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|