C27H28N2O3 — CID 145465485
3-ethenyl-N-hydroxy-2-[(Z)-prop-1-enyl]-6-[4-(4-propoxyphenyl)cyclohepta-1,3,5-trien-1-yl]pyridine-4-carboxamide (PubChem CID 145465485) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 3-ethenyl-N-hydroxy-2-[(Z)-prop-1-enyl]-6-[4-(4-propoxyphenyl)cyclohepta-1,3,5-trien-1-yl]pyridine-4-carboxamide.
| Compound Name | 3-ethenyl-N-hydroxy-2-[(Z)-prop-1-enyl]-6-[4-(4-propoxyphenyl)cyclohepta-1,3,5-trien-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 145465485 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 3-ethenyl-N-hydroxy-2-[(Z)-prop-1-enyl]-6-[4-(4-propoxyphenyl)cyclohepta-1,3,5-trien-1-yl]pyridine-4-carboxamide |
| SMILES | C=Cc1c(C(=O)NO)cc(C2=CC=C(c3ccc(OCCC)cc3)C=CC2)nc1/C=C\C |
| InChI | InChI=1S/C27H28N2O3/c1-4-8-25-23(6-3)24(27(30)29-31)18-26(28-25)21-10-7-9-19(11-12-21)20-13-15-22(16-14-20)32-17-5-2/h4,6-9,11-16,18,31H,3,5,10,17H2,1-2H3,(H,29,30)/b8-4- |
| InChIKey | HEAYNAGORZPLPS-YWEYNIOJSA-N |
| XLogP | 6.09 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|