About [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate
[(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate (PubChem CID 145465725) has the molecular formula C22H26O5
and a molecular weight of 370.45 g/mol. Its IUPAC name is [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate |
| PubChem CID | 145465725 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate |
| SMILES | C/C=C\COC(=O)c1ccc2cc(OCCCCCCOC=O)ccc2c1 |
| InChI | InChI=1S/C22H26O5/c1-2-3-13-27-22(24)20-9-8-19-16-21(11-10-18(19)15-20)26-14-7-5-4-6-12-25-17-23/h2-3,8-11,15-17H,4-7,12-14H2,1H3/b3-2- |
| InChIKey | MSLBOZNRXSPSII-IHWYPQMZSA-N |
| XLogP | 4.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate?
The IUPAC name of [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate (CID 145465725) is [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate.
What is the SMILES notation for [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate?
The canonical SMILES for [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate is C/C=C\COC(=O)c1ccc2cc(OCCCCCCOC=O)ccc2c1.
What is the InChIKey of [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate?
The InChIKey is MSLBOZNRXSPSII-IHWYPQMZSA-N. The full InChI is InChI=1S/C22H26O5/c1-2-3-13-27-22(24)20-9-8-19-16-21(11-10-18(19)15-20)26-14-7-5-4-6-12-25-17-23/h2-3,8-11,15-17H,4-7,12-14H2,1H3/b3-2-.
What are the key properties of [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate?
[(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate has a molecular weight of 370.45 g/mol, XLogP of 4.68, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-but-2-enyl] 6-(6-formyloxyhexoxy)naphthalene-2-carboxylate is sourced from PubChem (CID 145465725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).