About N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide
N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide (PubChem CID 145466024) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide |
| PubChem CID | 145466024 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide |
| SMILES | C=CNC(CCC)C(=O)C(=O)NCCC1C=NC=CC1 |
| InChI | InChI=1S/C15H23N3O2/c1-3-6-13(17-4-2)14(19)15(20)18-10-8-12-7-5-9-16-11-12/h4-5,9,11-13,17H,2-3,6-8,10H2,1H3,(H,18,20) |
| InChIKey | YXQNTQOJXCBUGA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide?
The IUPAC name of N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide (CID 145466024) is N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide.
What is the SMILES notation for N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide?
The canonical SMILES for N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide is C=CNC(CCC)C(=O)C(=O)NCCC1C=NC=CC1.
What is the InChIKey of N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide?
The InChIKey is YXQNTQOJXCBUGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-3-6-13(17-4-2)14(19)15(20)18-10-8-12-7-5-9-16-11-12/h4-5,9,11-13,17H,2-3,6-8,10H2,1H3,(H,18,20).
What are the key properties of N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide?
N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide has a molecular weight of 277.37 g/mol, XLogP of 1.57, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dihydropyridin-3-yl)ethyl]-3-(ethenylamino)-2-oxohexanamide is sourced from PubChem (CID 145466024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).