About 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen
3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen (PubChem CID 145466061) has the molecular formula C19H37NO2
and a molecular weight of 311.51 g/mol. Its IUPAC name is 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen.
Molecular Properties
| Compound Name | 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen |
| PubChem CID | 145466061 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen |
| SMILES | C=C(C)COCC(NC(=O)CCC1CCCCC1)C(C)(C)C.[H][H] |
| InChI | InChI=1S/C19H35NO2.H2/c1-15(2)13-22-14-17(19(3,4)5)20-18(21)12-11-16-9-7-6-8-10-16;/h16-17H,1,6-14H2,2-5H3,(H,20,21);1H |
| InChIKey | ARUQUWMQEYVJFG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen?
The IUPAC name of 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen (CID 145466061) is 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen.
What is the SMILES notation for 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen?
The canonical SMILES for 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen is C=C(C)COCC(NC(=O)CCC1CCCCC1)C(C)(C)C.[H][H].
What is the InChIKey of 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen?
The InChIKey is ARUQUWMQEYVJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35NO2.H2/c1-15(2)13-22-14-17(19(3,4)5)20-18(21)12-11-16-9-7-6-8-10-16;/h16-17H,1,6-14H2,2-5H3,(H,20,21);1H.
What are the key properties of 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen?
3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen has a molecular weight of 311.51 g/mol, XLogP of 4.72, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-N-[3,3-dimethyl-1-(2-methylprop-2-enoxy)butan-2-yl]propanamide;molecular hydrogen is sourced from PubChem (CID 145466061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).