C29H41N3O3S — CID 145466201
2-[4-methyl-3-[methyl(3-methylpentanoyl)amino]pentyl]-N-[(E)-4-methyl-5-oxo-1-phenylpent-3-en-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 145466201) has the molecular formula C29H41N3O3S and a molecular weight of 511.73 g/mol. Its IUPAC name is 2-[4-methyl-3-[methyl(3-methylpentanoyl)amino]pentyl]-N-[(E)-4-methyl-5-oxo-1-phenylpent-3-en-2-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-methyl-3-[methyl(3-methylpentanoyl)amino]pentyl]-N-[(E)-4-methyl-5-oxo-1-phenylpent-3-en-2-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 145466201 |
| Molecular Formula | C29H41N3O3S |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 2-[4-methyl-3-[methyl(3-methylpentanoyl)amino]pentyl]-N-[(E)-4-methyl-5-oxo-1-phenylpent-3-en-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCC(C)CC(=O)N(C)C(CCc1nc(C(=O)NC(/C=C(\C)C=O)Cc2ccccc2)cs1)C(C)C |
| InChI | InChI=1S/C29H41N3O3S/c1-7-21(4)16-28(34)32(6)26(20(2)3)13-14-27-31-25(19-36-27)29(35)30-24(15-22(5)18-33)17-23-11-9-8-10-12-23/h8-12,15,18-21,24,26H,7,13-14,16-17H2,1-6H3,(H,30,35)/b22-15+ |
| InChIKey | SJSHGSYFFOYGNH-PXLXIMEGSA-N |
| XLogP | 5.48 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|