C13H18FNO5 — CID 145466273
2-O-tert-butyl 3-O-fluoro 6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 145466273) has the molecular formula C13H18FNO5 and a molecular weight of 287.29 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-fluoro 6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-fluoro 6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 145466273 |
| Molecular Formula | C13H18FNO5 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-O-tert-butyl 3-O-fluoro 6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C(=O)CCC2C1C(=O)OF |
| InChI | InChI=1S/C13H18FNO5/c1-13(2,3)19-12(18)15-6-8-7(4-5-9(8)16)10(15)11(17)20-14/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | MIIHOEHOLORZBS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |