C10H17F3N2O2 — CID 145466442
N,3,3-trimethyl-2-(3,3,3-trifluoropropanoylamino)butanamide (PubChem CID 145466442) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is N,3,3-trimethyl-2-(3,3,3-trifluoropropanoylamino)butanamide.
| Compound Name | N,3,3-trimethyl-2-(3,3,3-trifluoropropanoylamino)butanamide |
|---|---|
| PubChem CID | 145466442 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N,3,3-trimethyl-2-(3,3,3-trifluoropropanoylamino)butanamide |
| SMILES | CNC(=O)C(NC(=O)CC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C10H17F3N2O2/c1-9(2,3)7(8(17)14-4)15-6(16)5-10(11,12)13/h7H,5H2,1-4H3,(H,14,17)(H,15,16) |
| InChIKey | CZEODVKVJQZZMI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |