About N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide
N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide (PubChem CID 145466519) has the molecular formula C15H26N2O3
and a molecular weight of 282.38 g/mol. Its IUPAC name is N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide.
Molecular Properties
| Compound Name | N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide |
| PubChem CID | 145466519 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide |
| SMILES | CNC(=O)C(NC(=O)C1CC12CCOCC2)C(C)(C)C |
| InChI | InChI=1S/C15H26N2O3/c1-14(2,3)11(13(19)16-4)17-12(18)10-9-15(10)5-7-20-8-6-15/h10-11H,5-9H2,1-4H3,(H,16,19)(H,17,18) |
| InChIKey | XWZOQPULYRZEDT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide?
The IUPAC name of N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide (CID 145466519) is N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide.
What is the SMILES notation for N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide?
The canonical SMILES for N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide is CNC(=O)C(NC(=O)C1CC12CCOCC2)C(C)(C)C.
What is the InChIKey of N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide?
The InChIKey is XWZOQPULYRZEDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O3/c1-14(2,3)11(13(19)16-4)17-12(18)10-9-15(10)5-7-20-8-6-15/h10-11H,5-9H2,1-4H3,(H,16,19)(H,17,18).
What are the key properties of N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide?
N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide has a molecular weight of 282.38 g/mol, XLogP of 1.08, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-6-oxaspiro[2.5]octane-2-carboxamide is sourced from PubChem (CID 145466519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).