About CID 145466882
CID 145466882 (PubChem CID 145466882) has the molecular formula C39H35BClF2N9O3
and a molecular weight of 762.03 g/mol.
Molecular Properties
| Compound Name | CID 145466882 |
| PubChem CID | 145466882 |
| Molecular Formula | C39H35BClF2N9O3 |
| Molecular Weight | 762.03 g/mol |
| Exact Mass | 761.26 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2ccccn2)nc1-c1ncc(F)c(N2CCOCC2)n1.[B]c1cc(Cl)c(O)c(-c2cc(C)cc(-c3ncc(F)c(N4CCOCC4)n3)n2)c1 |
| InChI | InChI=1S/C20H17BClFN4O2.C19H18FN5O/c1-11-6-16(13-8-12(21)9-14(22)18(13)28)25-17(7-11)19-24-10-15(23)20(26-19)27-2-4-29-5-3-27;1-13-5-6-16(15-4-2-3-7-21-15)23-17(13)18-22-12-14(20)19(24-18)25-8-10-26-11-9-25/h6-10,28H,2-5H2,1H3;2-7,12H,8-11H2,1H3 |
| InChIKey | SQIYDLYLAQZFKQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 762.03 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 145466882 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145466882?
The IUPAC name of CID 145466882 (CID 145466882) is not available.
What is the SMILES notation for CID 145466882?
The canonical SMILES for CID 145466882 is Cc1ccc(-c2ccccn2)nc1-c1ncc(F)c(N2CCOCC2)n1.[B]c1cc(Cl)c(O)c(-c2cc(C)cc(-c3ncc(F)c(N4CCOCC4)n3)n2)c1.
What is the InChIKey of CID 145466882?
The InChIKey is SQIYDLYLAQZFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17BClFN4O2.C19H18FN5O/c1-11-6-16(13-8-12(21)9-14(22)18(13)28)25-17(7-11)19-24-10-15(23)20(26-19)27-2-4-29-5-3-27;1-13-5-6-16(15-4-2-3-7-21-15)23-17(13)18-22-12-14(20)19(24-18)25-8-10-26-11-9-25/h6-10,28H,2-5H2,1H3;2-7,12H,8-11H2,1H3.
What are the key properties of CID 145466882?
CID 145466882 has a molecular weight of 762.03 g/mol, XLogP of 5.53, 6 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145466882 is sourced from PubChem (CID 145466882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).