About (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine
(E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine (PubChem CID 145467014) has the molecular formula C7H19N3
and a molecular weight of 145.25 g/mol. Its IUPAC name is (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine.
Molecular Properties
| Compound Name | (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine |
| PubChem CID | 145467014 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.16 |
| IUPAC Name | (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine |
| SMILES | CCNC/C(C)=C/N.CN |
| InChI | InChI=1S/C6H14N2.CH5N/c1-3-8-5-6(2)4-7;1-2/h4,8H,3,5,7H2,1-2H3;2H2,1H3/b6-4+; |
| InChIKey | TWIVBVVSAVZVJN-CVDVRWGVSA-N |
| XLogP | 0.03 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine?
The IUPAC name of (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine (CID 145467014) is (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine.
What is the SMILES notation for (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine?
The canonical SMILES for (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine is CCNC/C(C)=C/N.CN.
What is the InChIKey of (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine?
The InChIKey is TWIVBVVSAVZVJN-CVDVRWGVSA-N. The full InChI is InChI=1S/C6H14N2.CH5N/c1-3-8-5-6(2)4-7;1-2/h4,8H,3,5,7H2,1-2H3;2H2,1H3/b6-4+;.
What are the key properties of (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine?
(E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine has a molecular weight of 145.25 g/mol, XLogP of 0.03, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-ethyl-2-methylprop-1-ene-1,3-diamine;methanamine is sourced from PubChem (CID 145467014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).