C23H38O7 — CID 145467382
[(3R,5R,7R,8S,9R,12R,13S,15R)-8-methoxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadecan-14-yl] acetate (PubChem CID 145467382) has the molecular formula C23H38O7 and a molecular weight of 426.55 g/mol. Its IUPAC name is [(3R,5R,7R,8S,9R,12R,13S,15R)-8-methoxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadecan-14-yl] acetate.
| Compound Name | [(3R,5R,7R,8S,9R,12R,13S,15R)-8-methoxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadecan-14-yl] acetate |
|---|---|
| PubChem CID | 145467382 |
| Molecular Formula | C23H38O7 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | [(3R,5R,7R,8S,9R,12R,13S,15R)-8-methoxy-5,7,9,12,13,15-hexamethyl-10,16-dioxo-1,11-dioxaspiro[2.13]hexadecan-14-yl] acetate |
| SMILES | CO[C@H]1[C@H](C)C[C@@H](C)C[C@@]2(CO2)C(=O)[C@H](C)C(OC(C)=O)[C@@H](C)[C@@H](C)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C23H38O7/c1-12-9-13(2)19(27-8)16(5)22(26)29-17(6)14(3)20(30-18(7)24)15(4)21(25)23(10-12)11-28-23/h12-17,19-20H,9-11H2,1-8H3/t12-,13-,14+,15-,16-,17-,19+,20?,23-/m1/s1 |
| InChIKey | XQAMOLMLWUJOJU-XYNMBXHGSA-N |
| XLogP | 3.18 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|