About (2S,4S)-2,4-dimethyloxane;ethene;hydrate
(2S,4S)-2,4-dimethyloxane;ethene;hydrate (PubChem CID 145467490) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is (2S,4S)-2,4-dimethyloxane;ethene;hydrate.
Molecular Properties
| Compound Name | (2S,4S)-2,4-dimethyloxane;ethene;hydrate |
| PubChem CID | 145467490 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | (2S,4S)-2,4-dimethyloxane;ethene;hydrate |
| SMILES | C=C.C[C@H]1CCO[C@@H](C)C1.O |
| InChI | InChI=1S/C7H14O.C2H4.H2O/c1-6-3-4-8-7(2)5-6;1-2;/h6-7H,3-5H2,1-2H3;1-2H2;1H2/t6-,7-;;/m0../s1 |
| InChIKey | BGHPDLBRVFROSY-JFYKYWLVSA-N |
| XLogP | 1.80 |
| TPSA | 40.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-2,4-dimethyloxane;ethene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-2,4-dimethyloxane;ethene;hydrate?
The IUPAC name of (2S,4S)-2,4-dimethyloxane;ethene;hydrate (CID 145467490) is (2S,4S)-2,4-dimethyloxane;ethene;hydrate.
What is the SMILES notation for (2S,4S)-2,4-dimethyloxane;ethene;hydrate?
The canonical SMILES for (2S,4S)-2,4-dimethyloxane;ethene;hydrate is C=C.C[C@H]1CCO[C@@H](C)C1.O.
What is the InChIKey of (2S,4S)-2,4-dimethyloxane;ethene;hydrate?
The InChIKey is BGHPDLBRVFROSY-JFYKYWLVSA-N. The full InChI is InChI=1S/C7H14O.C2H4.H2O/c1-6-3-4-8-7(2)5-6;1-2;/h6-7H,3-5H2,1-2H3;1-2H2;1H2/t6-,7-;;/m0../s1.
What are the key properties of (2S,4S)-2,4-dimethyloxane;ethene;hydrate?
(2S,4S)-2,4-dimethyloxane;ethene;hydrate has a molecular weight of 160.26 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2,4-dimethyloxane;ethene;hydrate is sourced from PubChem (CID 145467490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).