C30H54O8 — CID 145467526
(3R,4S,5R,6R,9R,11R,12R,13S,14R)-14-ethyl-7,12,13-trihydroxy-3,5,6,7,9,11,13-heptamethyl-4-[(2S,4S,5R,6S)-4,5,6-trimethyloxan-2-yl]oxy-oxacyclotetradecane-2,10-dione (PubChem CID 145467526) has the molecular formula C30H54O8 and a molecular weight of 542.75 g/mol. Its IUPAC name is (3R,4S,5R,6R,9R,11R,12R,13S,14R)-14-ethyl-7,12,13-trihydroxy-3,5,6,7,9,11,13-heptamethyl-4-[(2S,4S,5R,6S)-4,5,6-trimethyloxan-2-yl]oxy-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,5R,6R,9R,11R,12R,13S,14R)-14-ethyl-7,12,13-trihydroxy-3,5,6,7,9,11,13-heptamethyl-4-[(2S,4S,5R,6S)-4,5,6-trimethyloxan-2-yl]oxy-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 145467526 |
| Molecular Formula | C30H54O8 |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | (3R,4S,5R,6R,9R,11R,12R,13S,14R)-14-ethyl-7,12,13-trihydroxy-3,5,6,7,9,11,13-heptamethyl-4-[(2S,4S,5R,6S)-4,5,6-trimethyloxan-2-yl]oxy-oxacyclotetradecane-2,10-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@H](C)[C@@H](C)[C@H](C)O2)[C@H](C)[C@@H](C)C(C)(O)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C30H54O8/c1-12-23-30(11,35)27(32)19(6)25(31)16(3)14-29(10,34)21(8)18(5)26(20(7)28(33)37-23)38-24-13-15(2)17(4)22(9)36-24/h15-24,26-27,32,34-35H,12-14H2,1-11H3/t15-,16+,17+,18+,19-,20+,21+,22-,23+,24-,26-,27+,29?,30+/m0/s1 |
| InChIKey | RPACGKDHJDDKHG-KXPGVCSNSA-N |
| XLogP | 4.12 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |