C30H56O7 — CID 145467895
(4S,9R,13R)-12,13-dihydroxy-7-methoxy-3,9,11,13-tetramethyl-4-[(2R,5S)-4,5,6-trimethylnonan-2-yl]oxy-oxacyclotetradecane-2,10-dione (PubChem CID 145467895) has the molecular formula C30H56O7 and a molecular weight of 528.77 g/mol. Its IUPAC name is (4S,9R,13R)-12,13-dihydroxy-7-methoxy-3,9,11,13-tetramethyl-4-[(2R,5S)-4,5,6-trimethylnonan-2-yl]oxy-oxacyclotetradecane-2,10-dione.
| Compound Name | (4S,9R,13R)-12,13-dihydroxy-7-methoxy-3,9,11,13-tetramethyl-4-[(2R,5S)-4,5,6-trimethylnonan-2-yl]oxy-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 145467895 |
| Molecular Formula | C30H56O7 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | (4S,9R,13R)-12,13-dihydroxy-7-methoxy-3,9,11,13-tetramethyl-4-[(2R,5S)-4,5,6-trimethylnonan-2-yl]oxy-oxacyclotetradecane-2,10-dione |
| SMILES | CCCC(C)[C@H](C)C(C)C[C@@H](C)O[C@H]1CCC(OC)C[C@@H](C)C(=O)C(C)C(O)[C@](C)(O)COC(=O)C1C |
| InChI | InChI=1S/C30H56O7/c1-11-12-18(2)22(6)19(3)15-21(5)37-26-14-13-25(35-10)16-20(4)27(31)24(8)28(32)30(9,34)17-36-29(33)23(26)7/h18-26,28,32,34H,11-17H2,1-10H3/t18?,19?,20-,21-,22+,23?,24?,25?,26+,28?,30-/m1/s1 |
| InChIKey | OJPKBKKZDYOMCK-PZWQFRFESA-N |
| XLogP | 5.19 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |