About 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine
2-ethenyl-4-imino-N,N-dimethylpentan-1-amine (PubChem CID 145468058) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine |
| PubChem CID | 145468058 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine |
| SMILES | [H]/N=C(\C)CC(C=C)CN(C)C |
| InChI | InChI=1S/C9H18N2/c1-5-9(6-8(2)10)7-11(3)4/h5,9-10H,1,6-7H2,2-4H3/b10-8+ |
| InChIKey | ATYWYFJMWBHLMM-CSKARUKUSA-N |
| XLogP | 1.78 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine?
The IUPAC name of 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine (CID 145468058) is 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine.
What is the SMILES notation for 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine?
The canonical SMILES for 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine is [H]/N=C(\C)CC(C=C)CN(C)C.
What is the InChIKey of 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine?
The InChIKey is ATYWYFJMWBHLMM-CSKARUKUSA-N. The full InChI is InChI=1S/C9H18N2/c1-5-9(6-8(2)10)7-11(3)4/h5,9-10H,1,6-7H2,2-4H3/b10-8+.
What are the key properties of 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine?
2-ethenyl-4-imino-N,N-dimethylpentan-1-amine has a molecular weight of 154.26 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4-imino-N,N-dimethylpentan-1-amine is sourced from PubChem (CID 145468058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).