About ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate
ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate (PubChem CID 145468281) has the molecular formula C14H24O9
and a molecular weight of 336.34 g/mol. Its IUPAC name is ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate.
Molecular Properties
| Compound Name | ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate |
| PubChem CID | 145468281 |
| Molecular Formula | C14H24O9 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate |
| SMILES | CC.COC(=O)CCC(=O)OCC(O)C(OC)C(=O)/C(O)=C/O |
| InChI | InChI=1S/C12H18O9.C2H6/c1-19-9(16)3-4-10(17)21-6-8(15)12(20-2)11(18)7(14)5-13;1-2/h5,8,12-15H,3-4,6H2,1-2H3;1-2H3/b7-5-; |
| InChIKey | DUYLRCHQNOMTCW-YJOCEBFMSA-N |
| XLogP | 0.41 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate?
The IUPAC name of ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate (CID 145468281) is ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate.
What is the SMILES notation for ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate?
The canonical SMILES for ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate is CC.COC(=O)CCC(=O)OCC(O)C(OC)C(=O)/C(O)=C/O.
What is the InChIKey of ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate?
The InChIKey is DUYLRCHQNOMTCW-YJOCEBFMSA-N. The full InChI is InChI=1S/C12H18O9.C2H6/c1-19-9(16)3-4-10(17)21-6-8(15)12(20-2)11(18)7(14)5-13;1-2/h5,8,12-15H,3-4,6H2,1-2H3;1-2H3/b7-5-;.
What are the key properties of ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate?
ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate has a molecular weight of 336.34 g/mol, XLogP of 0.41, 9 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate is sourced from PubChem (CID 145468281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).