About 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate
1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate (PubChem CID 145468282) has the molecular formula C12H18O9
and a molecular weight of 306.27 g/mol. Its IUPAC name is 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate |
| PubChem CID | 145468282 |
| Molecular Formula | C12H18O9 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate |
| SMILES | COC(=O)CCC(=O)OCC(O)C(OC)C(=O)/C(O)=C/O |
| InChI | InChI=1S/C12H18O9/c1-19-9(16)3-4-10(17)21-6-8(15)12(20-2)11(18)7(14)5-13/h5,8,12-15H,3-4,6H2,1-2H3/b7-5- |
| InChIKey | UZFZQRMXIVUSMC-ALCCZGGFSA-N |
| XLogP | -0.61 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate?
The IUPAC name of 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate (CID 145468282) is 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate.
What is the SMILES notation for 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate?
The canonical SMILES for 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate is COC(=O)CCC(=O)OCC(O)C(OC)C(=O)/C(O)=C/O.
What is the InChIKey of 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate?
The InChIKey is UZFZQRMXIVUSMC-ALCCZGGFSA-N. The full InChI is InChI=1S/C12H18O9/c1-19-9(16)3-4-10(17)21-6-8(15)12(20-2)11(18)7(14)5-13/h5,8,12-15H,3-4,6H2,1-2H3/b7-5-.
What are the key properties of 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate?
1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate has a molecular weight of 306.27 g/mol, XLogP of -0.61, 9 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 4-O-[(Z)-2,5,6-trihydroxy-3-methoxy-4-oxohex-5-enyl] butanedioate is sourced from PubChem (CID 145468282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).