About 6,12-dimethylhexadecylcyclopentane;ethane;methane
6,12-dimethylhexadecylcyclopentane;ethane;methane (PubChem CID 145468436) has the molecular formula C26H56
and a molecular weight of 368.73 g/mol. Its IUPAC name is 6,12-dimethylhexadecylcyclopentane;ethane;methane.
Molecular Properties
| Compound Name | 6,12-dimethylhexadecylcyclopentane;ethane;methane |
| PubChem CID | 145468436 |
| Molecular Formula | C26H56 |
| Molecular Weight | 368.73 g/mol |
| Exact Mass | 368.44 |
| IUPAC Name | 6,12-dimethylhexadecylcyclopentane;ethane;methane |
| SMILES | C.CC.CCCCC(C)CCCCCC(C)CCCCCC1CCCC1 |
| InChI | InChI=1S/C23H46.C2H6.CH4/c1-4-5-14-21(2)15-8-6-9-16-22(3)17-10-7-11-18-23-19-12-13-20-23;1-2;/h21-23H,4-20H2,1-3H3;1-2H3;1H4 |
| InChIKey | PSOLELYAGZBBPQ-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.73 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,12-dimethylhexadecylcyclopentane;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,12-dimethylhexadecylcyclopentane;ethane;methane?
The IUPAC name of 6,12-dimethylhexadecylcyclopentane;ethane;methane (CID 145468436) is 6,12-dimethylhexadecylcyclopentane;ethane;methane.
What is the SMILES notation for 6,12-dimethylhexadecylcyclopentane;ethane;methane?
The canonical SMILES for 6,12-dimethylhexadecylcyclopentane;ethane;methane is C.CC.CCCCC(C)CCCCCC(C)CCCCCC1CCCC1.
What is the InChIKey of 6,12-dimethylhexadecylcyclopentane;ethane;methane?
The InChIKey is PSOLELYAGZBBPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46.C2H6.CH4/c1-4-5-14-21(2)15-8-6-9-16-22(3)17-10-7-11-18-23-19-12-13-20-23;1-2;/h21-23H,4-20H2,1-3H3;1-2H3;1H4.
What are the key properties of 6,12-dimethylhexadecylcyclopentane;ethane;methane?
6,12-dimethylhexadecylcyclopentane;ethane;methane has a molecular weight of 368.73 g/mol, XLogP of 10.20, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,12-dimethylhexadecylcyclopentane;ethane;methane is sourced from PubChem (CID 145468436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).