C17H22N6OS — CID 145468511
3-amino-N-[2-(4-aminopiperidin-1-yl)-5-methylsulfanylphenyl]pyrazine-2-carboxamide (PubChem CID 145468511) has the molecular formula C17H22N6OS and a molecular weight of 358.47 g/mol. Its IUPAC name is 3-amino-N-[2-(4-aminopiperidin-1-yl)-5-methylsulfanylphenyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[2-(4-aminopiperidin-1-yl)-5-methylsulfanylphenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 145468511 |
| Molecular Formula | C17H22N6OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-amino-N-[2-(4-aminopiperidin-1-yl)-5-methylsulfanylphenyl]pyrazine-2-carboxamide |
| SMILES | CSc1ccc(N2CCC(N)CC2)c(NC(=O)c2nccnc2N)c1 |
| InChI | InChI=1S/C17H22N6OS/c1-25-12-2-3-14(23-8-4-11(18)5-9-23)13(10-12)22-17(24)15-16(19)21-7-6-20-15/h2-3,6-7,10-11H,4-5,8-9,18H2,1H3,(H2,19,21)(H,22,24) |
| InChIKey | IHCCPRKLCOHVGQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |