About CID 145469155
CID 145469155 (PubChem CID 145469155) has the molecular formula C7H4BFO2
and a molecular weight of 149.92 g/mol.
Molecular Properties
| Compound Name | CID 145469155 |
| PubChem CID | 145469155 |
| Molecular Formula | C7H4BFO2 |
| Molecular Weight | 149.92 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | — |
| SMILES | [B]Oc1ccc(C=O)c(F)c1 |
| InChI | InChI=1S/C7H4BFO2/c8-11-6-2-1-5(4-10)7(9)3-6/h1-4H |
| InChIKey | LIJUOKXNGQBLNS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.92 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 145469155 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145469155?
The IUPAC name of CID 145469155 (CID 145469155) is not available.
What is the SMILES notation for CID 145469155?
The canonical SMILES for CID 145469155 is [B]Oc1ccc(C=O)c(F)c1.
What is the InChIKey of CID 145469155?
The InChIKey is LIJUOKXNGQBLNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BFO2/c8-11-6-2-1-5(4-10)7(9)3-6/h1-4H.
What are the key properties of CID 145469155?
CID 145469155 has a molecular weight of 149.92 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145469155 is sourced from PubChem (CID 145469155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).