About 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile
3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile (PubChem CID 145469709) has the molecular formula C24H23N3
and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile |
| PubChem CID | 145469709 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile |
| SMILES | CCc1c(C)nc2cc(C(C)(C#N)Cc3cccc(C#N)c3)ccc2c1C |
| InChI | InChI=1S/C24H23N3/c1-5-21-16(2)22-10-9-20(12-23(22)27-17(21)3)24(4,15-26)13-18-7-6-8-19(11-18)14-25/h6-12H,5,13H2,1-4H3 |
| InChIKey | PRFFBFJKCMZSTC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile?
The IUPAC name of 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile (CID 145469709) is 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile.
What is the SMILES notation for 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile?
The canonical SMILES for 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile is CCc1c(C)nc2cc(C(C)(C#N)Cc3cccc(C#N)c3)ccc2c1C.
What is the InChIKey of 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile?
The InChIKey is PRFFBFJKCMZSTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3/c1-5-21-16(2)22-10-9-20(12-23(22)27-17(21)3)24(4,15-26)13-18-7-6-8-19(11-18)14-25/h6-12H,5,13H2,1-4H3.
What are the key properties of 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile?
3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile has a molecular weight of 353.47 g/mol, XLogP of 5.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-cyano-2-(3-ethyl-2,4-dimethylquinolin-7-yl)propyl]benzonitrile is sourced from PubChem (CID 145469709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).