C25H28N2O2 — CID 145469808
3-(3-acetylphenyl)-2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2-methylpropanenitrile;ethane (PubChem CID 145469808) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-(3-acetylphenyl)-2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2-methylpropanenitrile;ethane.
| Compound Name | 3-(3-acetylphenyl)-2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2-methylpropanenitrile;ethane |
|---|---|
| PubChem CID | 145469808 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 3-(3-acetylphenyl)-2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2-methylpropanenitrile;ethane |
| SMILES | CC.CCc1cc2ccc(C(C)(C#N)Cc3cccc(C(C)=O)c3)cc2[nH]c1=O |
| InChI | InChI=1S/C23H22N2O2.C2H6/c1-4-17-11-19-8-9-20(12-21(19)25-22(17)27)23(3,14-24)13-16-6-5-7-18(10-16)15(2)26;1-2/h5-12H,4,13H2,1-3H3,(H,25,27);1-2H3 |
| InChIKey | WMTOFHGYUFZGQS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |