C21H20N6O4 — CID 145471711
N-[[2-[(Z)-3-amino-1,4-dioxopent-2-en-2-yl]-3,4-dihydro-1H-isoquinolin-7-yl]methyl]-5-cyano-6-oxo-1H-pyrimidine-2-carboxamide (PubChem CID 145471711) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-[[2-[(Z)-3-amino-1,4-dioxopent-2-en-2-yl]-3,4-dihydro-1H-isoquinolin-7-yl]methyl]-5-cyano-6-oxo-1H-pyrimidine-2-carboxamide.
| Compound Name | N-[[2-[(Z)-3-amino-1,4-dioxopent-2-en-2-yl]-3,4-dihydro-1H-isoquinolin-7-yl]methyl]-5-cyano-6-oxo-1H-pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 145471711 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[[2-[(Z)-3-amino-1,4-dioxopent-2-en-2-yl]-3,4-dihydro-1H-isoquinolin-7-yl]methyl]-5-cyano-6-oxo-1H-pyrimidine-2-carboxamide |
| SMILES | CC(=O)/C(N)=C(\C=O)N1CCc2ccc(CNC(=O)c3ncc(C#N)c(=O)[nH]3)cc2C1 |
| InChI | InChI=1S/C21H20N6O4/c1-12(29)18(23)17(11-28)27-5-4-14-3-2-13(6-15(14)10-27)8-25-21(31)19-24-9-16(7-22)20(30)26-19/h2-3,6,9,11H,4-5,8,10,23H2,1H3,(H,25,31)(H,24,26,30)/b18-17- |
| InChIKey | MLSDILNAJQNSQP-ZCXUNETKSA-N |
| XLogP | -0.11 |
| TPSA | 162.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|