About 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+)
5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+) (PubChem CID 145471989) has the molecular formula C6H8N3ORu
and a molecular weight of 239.22 g/mol. Its IUPAC name is 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+).
Molecular Properties
| Compound Name | 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+) |
| PubChem CID | 145471989 |
| Molecular Formula | C6H8N3ORu |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+) |
| SMILES | Cc1ncc(CN)c(=O)[n-]1.[Ru+] |
| InChI | InChI=1S/C6H9N3O.Ru/c1-4-8-3-5(2-7)6(10)9-4;/h3H,2,7H2,1H3,(H,8,9,10);/q;+1/p-1 |
| InChIKey | UIJFKFSBEIFTSS-UHFFFAOYSA-M |
| XLogP | -0.84 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+)?
The IUPAC name of 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+) (CID 145471989) is 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+).
What is the SMILES notation for 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+)?
The canonical SMILES for 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+) is Cc1ncc(CN)c(=O)[n-]1.[Ru+].
What is the InChIKey of 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+)?
The InChIKey is UIJFKFSBEIFTSS-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H9N3O.Ru/c1-4-8-3-5(2-7)6(10)9-4;/h3H,2,7H2,1H3,(H,8,9,10);/q;+1/p-1.
What are the key properties of 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+)?
5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+) has a molecular weight of 239.22 g/mol, XLogP of -0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-2-methylpyrimidin-3-id-4-one;ruthenium(1+) is sourced from PubChem (CID 145471989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).