C20H24N2 — CID 145472073
acetylene;N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]-2-methylidene-3,4-dihydro-1H-quinolin-7-amine (PubChem CID 145472073) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is acetylene;N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]-2-methylidene-3,4-dihydro-1H-quinolin-7-amine.
| Compound Name | acetylene;N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]-2-methylidene-3,4-dihydro-1H-quinolin-7-amine |
|---|---|
| PubChem CID | 145472073 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | acetylene;N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]-2-methylidene-3,4-dihydro-1H-quinolin-7-amine |
| SMILES | C#C.C=C1CCc2ccc(NC(=C)C(/C=C\C)=C/C)cc2N1 |
| InChI | InChI=1S/C18H22N2.C2H2/c1-5-7-15(6-2)14(4)20-17-11-10-16-9-8-13(3)19-18(16)12-17;1-2/h5-7,10-12,19-20H,3-4,8-9H2,1-2H3;1-2H/b7-5-,15-6+; |
| InChIKey | SDCJQCUPVPKVRS-GFWSULSGSA-N |
| XLogP | 5.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|