About ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine
ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine (PubChem CID 145472464) has the molecular formula C21H45NO
and a molecular weight of 327.60 g/mol. Its IUPAC name is ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine.
Molecular Properties
| Compound Name | ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine |
| PubChem CID | 145472464 |
| Molecular Formula | C21H45NO |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 327.35 |
| IUPAC Name | ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine |
| SMILES | C/C=C\C(=C/C)CCCN1CCOCC1.C=C.CC.CC.CC |
| InChI | InChI=1S/C13H23NO.3C2H6.C2H4/c1-3-6-13(4-2)7-5-8-14-9-11-15-12-10-14;4*1-2/h3-4,6H,5,7-12H2,1-2H3;3*1-2H3;1-2H2/b6-3-,13-4+;;;; |
| InChIKey | BMVBDTSXODMGJC-HUEXPVEHSA-N |
| XLogP | 6.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine?
The IUPAC name of ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine (CID 145472464) is ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine.
What is the SMILES notation for ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine?
The canonical SMILES for ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine is C/C=C\C(=C/C)CCCN1CCOCC1.C=C.CC.CC.CC.
What is the InChIKey of ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine?
The InChIKey is BMVBDTSXODMGJC-HUEXPVEHSA-N. The full InChI is InChI=1S/C13H23NO.3C2H6.C2H4/c1-3-6-13(4-2)7-5-8-14-9-11-15-12-10-14;4*1-2/h3-4,6H,5,7-12H2,1-2H3;3*1-2H3;1-2H2/b6-3-,13-4+;;;;.
What are the key properties of ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine?
ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine has a molecular weight of 327.60 g/mol, XLogP of 6.50, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;4-[(Z,4Z)-4-ethylidenehept-5-enyl]morpholine is sourced from PubChem (CID 145472464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).