C20H29FN2O — CID 145472632
3-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]oxy-1-N-[(3-fluorophenyl)methyl]-1-N-methylpropane-1,2-diamine (PubChem CID 145472632) has the molecular formula C20H29FN2O and a molecular weight of 332.46 g/mol. Its IUPAC name is 3-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]oxy-1-N-[(3-fluorophenyl)methyl]-1-N-methylpropane-1,2-diamine.
| Compound Name | 3-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]oxy-1-N-[(3-fluorophenyl)methyl]-1-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 145472632 |
| Molecular Formula | C20H29FN2O |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 3-[(2E,4Z)-5-ethylhepta-2,4,6-trien-3-yl]oxy-1-N-[(3-fluorophenyl)methyl]-1-N-methylpropane-1,2-diamine |
| SMILES | C=C/C(=C\C(=C/C)OCC(N)CN(C)Cc1cccc(F)c1)CC |
| InChI | InChI=1S/C20H29FN2O/c1-5-16(6-2)12-20(7-3)24-15-19(22)14-23(4)13-17-9-8-10-18(21)11-17/h5,7-12,19H,1,6,13-15,22H2,2-4H3/b16-12+,20-7+ |
| InChIKey | GGBMUVXOTFBSDH-ZAVXQQGNSA-N |
| XLogP | 4.03 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|