C18H33NO4 — CID 145472938
tert-butyl N-[1-hydroxy-3-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-yl]carbamate;ethane (PubChem CID 145472938) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl N-[1-hydroxy-3-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-hydroxy-3-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 145472938 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl N-[1-hydroxy-3-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-yl]carbamate;ethane |
| SMILES | C=C/C(C)=C\C(=C/C)OCC(CO)NC(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C16H27NO4.C2H6/c1-7-12(3)9-14(8-2)20-11-13(10-18)17-15(19)21-16(4,5)6;1-2/h7-9,13,18H,1,10-11H2,2-6H3,(H,17,19);1-2H3/b12-9-,14-8+; |
| InChIKey | KOUKUEUWZWQMDY-LLFNSEDPSA-N |
| XLogP | 3.95 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|