C13H25NO — CID 145473105
ethane;1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-amine (PubChem CID 145473105) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-amine.
| Compound Name | ethane;1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-amine |
|---|---|
| PubChem CID | 145473105 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;1-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxypropan-2-amine |
| SMILES | C=C/C(C)=C\C(=C/C)OCC(C)N.CC |
| InChI | InChI=1S/C11H19NO.C2H6/c1-5-9(3)7-11(6-2)13-8-10(4)12;1-2/h5-7,10H,1,8,12H2,2-4H3;1-2H3/b9-7-,11-6+; |
| InChIKey | VRTQYDRHQSQXPV-SMBIFVNMSA-N |
| XLogP | 3.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|