About ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid
ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid (PubChem CID 145473222) has the molecular formula C15H22BFO3
and a molecular weight of 280.15 g/mol. Its IUPAC name is ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid.
Molecular Properties
| Compound Name | ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid |
| PubChem CID | 145473222 |
| Molecular Formula | C15H22BFO3 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid |
| SMILES | C/C=C\C(=C/C)COc1ccc(B(O)O)c(F)c1.CC |
| InChI | InChI=1S/C13H16BFO3.C2H6/c1-3-5-10(4-2)9-18-11-6-7-12(14(16)17)13(15)8-11;1-2/h3-8,16-17H,9H2,1-2H3;1-2H3/b5-3-,10-4+; |
| InChIKey | SZMTYYQEWPECBQ-BOWQZNNWSA-N |
| XLogP | 2.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid?
The IUPAC name of ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid (CID 145473222) is ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid.
What is the SMILES notation for ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid?
The canonical SMILES for ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid is C/C=C\C(=C/C)COc1ccc(B(O)O)c(F)c1.CC.
What is the InChIKey of ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid?
The InChIKey is SZMTYYQEWPECBQ-BOWQZNNWSA-N. The full InChI is InChI=1S/C13H16BFO3.C2H6/c1-3-5-10(4-2)9-18-11-6-7-12(14(16)17)13(15)8-11;1-2/h3-8,16-17H,9H2,1-2H3;1-2H3/b5-3-,10-4+;.
What are the key properties of ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid?
ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid has a molecular weight of 280.15 g/mol, XLogP of 2.43, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[4-[(Z,2E)-2-ethylidenepent-3-enoxy]-2-fluorophenyl]boronic acid is sourced from PubChem (CID 145473222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).