C23H30N+ — CID 145473308
1-methyl-2-(2-methyl-5-propylphenyl)quinolin-1-ium;propane (PubChem CID 145473308) has the molecular formula C23H30N+ and a molecular weight of 320.50 g/mol. Its IUPAC name is 1-methyl-2-(2-methyl-5-propylphenyl)quinolin-1-ium;propane.
| Compound Name | 1-methyl-2-(2-methyl-5-propylphenyl)quinolin-1-ium;propane |
|---|---|
| PubChem CID | 145473308 |
| Molecular Formula | C23H30N+ |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 1-methyl-2-(2-methyl-5-propylphenyl)quinolin-1-ium;propane |
| SMILES | CCC.CCCc1ccc(C)c(-c2ccc3ccccc3[n+]2C)c1 |
| InChI | InChI=1S/C20H22N.C3H8/c1-4-7-16-11-10-15(2)18(14-16)20-13-12-17-8-5-6-9-19(17)21(20)3;1-3-2/h5-6,8-14H,4,7H2,1-3H3;3H2,1-2H3/q+1; |
| InChIKey | MPWICKKHVXXJQZ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|