C30H52N2O2 — CID 145473378
3',11,12b-trimethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-azuleno[2,1-f]quinoline-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one;ethane (PubChem CID 145473378) has the molecular formula C30H52N2O2 and a molecular weight of 472.76 g/mol. Its IUPAC name is 3',11,12b-trimethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-azuleno[2,1-f]quinoline-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one;ethane.
| Compound Name | 3',11,12b-trimethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-azuleno[2,1-f]quinoline-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one;ethane |
|---|---|
| PubChem CID | 145473378 |
| Molecular Formula | C30H52N2O2 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 472.40 |
| IUPAC Name | 3',11,12b-trimethylspiro[2,4,4a,5,6,6a,6b,7,8,10,12,12a-dodecahydro-1H-azuleno[2,1-f]quinoline-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one;ethane |
| SMILES | CC.CC.CC1=C2CC3C(CCC4NC(=O)CCC43C)C2CCC2(C1)OC1CCCNC1C2C |
| InChI | InChI=1S/C26H40N2O2.2C2H6/c1-15-14-26(16(2)24-21(30-26)5-4-12-27-24)11-8-17-18-6-7-22-25(3,10-9-23(29)28-22)20(18)13-19(15)17;2*1-2/h16-18,20-22,24,27H,4-14H2,1-3H3,(H,28,29);2*1-2H3 |
| InChIKey | NHMLKYHARVFXQJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|