About 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate
3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate (PubChem CID 145473465) has the molecular formula C19H18F3NO4S2
and a molecular weight of 445.48 g/mol. Its IUPAC name is 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate.
Molecular Properties
| Compound Name | 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate |
| PubChem CID | 145473465 |
| Molecular Formula | C19H18F3NO4S2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate |
| SMILES | CC(=O)OC(F)(F)F.CC(CC(=O)O)NSc1ccc(C#Cc2ccccc2)s1 |
| InChI | InChI=1S/C16H15NO2S2.C3H3F3O2/c1-12(11-15(18)19)17-21-16-10-9-14(20-16)8-7-13-5-3-2-4-6-13;1-2(7)8-3(4,5)6/h2-6,9-10,12,17H,11H2,1H3,(H,18,19);1H3 |
| InChIKey | ZPADIXZQIQVTQL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate?
The IUPAC name of 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate (CID 145473465) is 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate.
What is the SMILES notation for 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate?
The canonical SMILES for 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate is CC(=O)OC(F)(F)F.CC(CC(=O)O)NSc1ccc(C#Cc2ccccc2)s1.
What is the InChIKey of 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate?
The InChIKey is ZPADIXZQIQVTQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2S2.C3H3F3O2/c1-12(11-15(18)19)17-21-16-10-9-14(20-16)8-7-13-5-3-2-4-6-13;1-2(7)8-3(4,5)6/h2-6,9-10,12,17H,11H2,1H3,(H,18,19);1H3.
What are the key properties of 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate?
3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate has a molecular weight of 445.48 g/mol, XLogP of 4.68, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(2-phenylethynyl)thiophen-2-yl]sulfanylamino]butanoic acid;trifluoromethyl acetate is sourced from PubChem (CID 145473465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).