About 1-ethoxybutan-2-amine;furan-2-ylmethanamine
1-ethoxybutan-2-amine;furan-2-ylmethanamine (PubChem CID 145473642) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-ethoxybutan-2-amine;furan-2-ylmethanamine.
Molecular Properties
| Compound Name | 1-ethoxybutan-2-amine;furan-2-ylmethanamine |
| PubChem CID | 145473642 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-ethoxybutan-2-amine;furan-2-ylmethanamine |
| SMILES | CCOCC(N)CC.NCc1ccco1 |
| InChI | InChI=1S/C6H15NO.C5H7NO/c1-3-6(7)5-8-4-2;6-4-5-2-1-3-7-5/h6H,3-5,7H2,1-2H3;1-3H,4,6H2 |
| InChIKey | GIIOPADFYVDGHW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethoxybutan-2-amine;furan-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxybutan-2-amine;furan-2-ylmethanamine?
The IUPAC name of 1-ethoxybutan-2-amine;furan-2-ylmethanamine (CID 145473642) is 1-ethoxybutan-2-amine;furan-2-ylmethanamine.
What is the SMILES notation for 1-ethoxybutan-2-amine;furan-2-ylmethanamine?
The canonical SMILES for 1-ethoxybutan-2-amine;furan-2-ylmethanamine is CCOCC(N)CC.NCc1ccco1.
What is the InChIKey of 1-ethoxybutan-2-amine;furan-2-ylmethanamine?
The InChIKey is GIIOPADFYVDGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO.C5H7NO/c1-3-6(7)5-8-4-2;6-4-5-2-1-3-7-5/h6H,3-5,7H2,1-2H3;1-3H,4,6H2.
What are the key properties of 1-ethoxybutan-2-amine;furan-2-ylmethanamine?
1-ethoxybutan-2-amine;furan-2-ylmethanamine has a molecular weight of 214.31 g/mol, XLogP of 1.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxybutan-2-amine;furan-2-ylmethanamine is sourced from PubChem (CID 145473642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).