C16H20F3NO4 — CID 145473798
N-hydroxy-8-oxo-7-[[4-(trifluoromethyl)phenyl]methoxy]octanamide (PubChem CID 145473798) has the molecular formula C16H20F3NO4 and a molecular weight of 347.33 g/mol. Its IUPAC name is N-hydroxy-8-oxo-7-[[4-(trifluoromethyl)phenyl]methoxy]octanamide.
| Compound Name | N-hydroxy-8-oxo-7-[[4-(trifluoromethyl)phenyl]methoxy]octanamide |
|---|---|
| PubChem CID | 145473798 |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-hydroxy-8-oxo-7-[[4-(trifluoromethyl)phenyl]methoxy]octanamide |
| SMILES | O=CC(CCCCCC(=O)NO)OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3NO4/c17-16(18,19)13-8-6-12(7-9-13)11-24-14(10-21)4-2-1-3-5-15(22)20-23/h6-10,14,23H,1-5,11H2,(H,20,22) |
| InChIKey | POJXMLWNQDAYHW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|