C20H21N3O2 — CID 14547384
2-(4-aminobenzoyl)-1,3,6,7,8,12b-hexahydropyrazino[2,1-a][2]benzazepin-4-one (PubChem CID 14547384) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-(4-aminobenzoyl)-1,3,6,7,8,12b-hexahydropyrazino[2,1-a][2]benzazepin-4-one.
| Compound Name | 2-(4-aminobenzoyl)-1,3,6,7,8,12b-hexahydropyrazino[2,1-a][2]benzazepin-4-one |
|---|---|
| PubChem CID | 14547384 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-(4-aminobenzoyl)-1,3,6,7,8,12b-hexahydropyrazino[2,1-a][2]benzazepin-4-one |
| SMILES | Nc1ccc(C(=O)N2CC(=O)N3CCCc4ccccc4C3C2)cc1 |
| InChI | InChI=1S/C20H21N3O2/c21-16-9-7-15(8-10-16)20(25)22-12-18-17-6-2-1-4-14(17)5-3-11-23(18)19(24)13-22/h1-2,4,6-10,18H,3,5,11-13,21H2 |
| InChIKey | YTHMXIWJTQUKFU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|